* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | WUXIAPPTEC WX115082-001 |
English Synonyms: | WUXIAPPTEC WX115082-010 ; WUXIAPPTEC WX115082-005 ; WUXIAPPTEC WX115082-001 |
MDL Number.: | MFCD17016574 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | O=C(OCC1=CC=CC=C1)N1CC2CNCC2C2=C(C1)C=CC=C2 |
InChi: | InChI=1S/C20H22N2O2/c23-20(24-14-15-6-2-1-3-7-15)22-12-16-8-4-5-9-18(16)19-11-21-10-17(19)13-22/h1-9,17,19,21H,10-14H2 |
InChiKey: | InChIKey=MZMQQXHCCHAAKP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.