* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | WUXIAPPTEC WX115084-001 |
English Synonyms: | WUXIAPPTEC WX115084-010 ; WUXIAPPTEC WX115084-005 ; WUXIAPPTEC WX115084-001 |
MDL Number.: | MFCD17016576 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | BrC1=CC=C(C=C1)C12CCNC1COCC2 |
InChi: | InChI=1S/C13H16BrNO/c14-11-3-1-10(2-4-11)13-5-7-15-12(13)9-16-8-6-13/h1-4,12,15H,5-9H2 |
InChiKey: | InChIKey=CPZCZCILGZZMIE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.