* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115087-001 |
| English Synonyms: | WUXIAPPTEC WX115087-005 ; WUXIAPPTEC WX115087-001 ; WUXIAPPTEC WX115087-010 |
| MDL Number.: | MFCD17016577 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CC(C)(C)OC(=O)N1CC[C@@H]2NC3=CC=CC=C3S(=O)(=O)N[C@H]2CC1 |
| InChi: | InChI=1S/C17H25N3O4S/c1-17(2,3)24-16(21)20-10-8-12-13(9-11-20)19-25(22,23)15-7-5-4-6-14(15)18-12/h4-7,12-13,18-19H,8-11H2,1-3H3/t12-,13-/m0/s1 |
| InChiKey: | InChIKey=UKZPWLBUSOBBTH-STQMWFEESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.