* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115092-001 |
| English Synonyms: | WUXIAPPTEC WX115092-005 ; WUXIAPPTEC WX115092-010 ; WUXIAPPTEC WX115092-001 |
| MDL Number.: | MFCD17016579 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1C[C@@H]2OC(C(O)=O)C3=CC=NN3[C@@H]2C1 |
| InChi: | InChI=1S/C14H19N3O5/c1-14(2,3)22-13(20)16-6-9-10(7-16)21-11(12(18)19)8-4-5-15-17(8)9/h4-5,9-11H,6-7H2,1-3H3,(H,18,19)/t9-,10+,11?/m1/s1 |
| InChiKey: | InChIKey=QAYPLNORBWFPGN-JKIOLJMWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.