* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115104-001 |
| English Synonyms: | WUXIAPPTEC WX115104-005 ; WUXIAPPTEC WX115104-010 ; WUXIAPPTEC WX115104-001 |
| MDL Number.: | MFCD17016590 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | [H][C@@]12CCN(CC[C@]1([H])N1CCNCC1CO2)C(=O)OC(C)(C)C |
| InChi: | InChI=1S/C16H29N3O3/c1-16(2,3)22-15(20)18-7-4-13-14(5-8-18)21-11-12-10-17-6-9-19(12)13/h12-14,17H,4-11H2,1-3H3/t12?,13-,14+/m0/s1 |
| InChiKey: | InChIKey=WRCISSQKFYHHJS-KFTPUPIBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.