* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115108-001 |
| English Synonyms: | WUXIAPPTEC WX115108-010 ; WUXIAPPTEC WX115108-001 ; WUXIAPPTEC WX115108-005 |
| MDL Number.: | MFCD17016594 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | [H][C@@]12CN(CC[C@]1([H])N1CCN(CC1CNC2)C(=O)OCC1=CC=CC=C1)C(=O)OC(C)(C)C |
| InChi: | InChI=1S/C24H36N4O4/c1-24(2,3)32-23(30)26-10-9-21-19(15-26)13-25-14-20-16-27(11-12-28(20)21)22(29)31-17-18-7-5-4-6-8-18/h4-8,19-21,25H,9-17H2,1-3H3/t19-,20?,21+/m1/s1 |
| InChiKey: | InChIKey=HALLRBMINPFCFY-TYVLQRECSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.