* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115109-001 |
| English Synonyms: | WUXIAPPTEC WX115109-001 ; WUXIAPPTEC WX115109-005 ; WUXIAPPTEC WX115109-010 |
| MDL Number.: | MFCD17016595 |
| H bond acceptor: | 9 |
| H bond donor: | 1 |
| Smile: | [H][C@]12CN(C[C@@]1([H])C(=O)NCC1CN(CCN21)C(=O)OCC1=CC=CC=C1)C(=O)OC(C)(C)C |
| InChi: | InChI=1S/C23H32N4O5/c1-23(2,3)32-22(30)26-13-18-19(14-26)27-10-9-25(12-17(27)11-24-20(18)28)21(29)31-15-16-7-5-4-6-8-16/h4-8,17-19H,9-15H2,1-3H3,(H,24,28)/t17?,18-,19+/m1/s1 |
| InChiKey: | InChIKey=VNZNTKLVPGOGQN-CPSIJMPNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.