* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115112-001 |
| English Synonyms: | WUXIAPPTEC WX115112-005 ; WUXIAPPTEC WX115112-001 ; WUXIAPPTEC WX115112-010 |
| MDL Number.: | MFCD17016598 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | [H][C@]12CCN(CC[C@@]1([H])C(=O)NCC1COCCN21)C(=O)OC(C)(C)C |
| InChi: | InChI=1S/C17H29N3O4/c1-17(2,3)24-16(22)19-6-4-13-14(5-7-19)20-8-9-23-11-12(20)10-18-15(13)21/h12-14H,4-11H2,1-3H3,(H,18,21)/t12?,13-,14+/m1/s1 |
| InChiKey: | InChIKey=AJTRYVVUVGGKLA-IUZLNWEFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.