* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115118-001 |
| English Synonyms: | WUXIAPPTEC WX115118-010 ; WUXIAPPTEC WX115118-001 ; WUXIAPPTEC WX115118-005 |
| MDL Number.: | MFCD17016602 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | [H][C@@]12CCN(C[C@]1([H])[C@H](CN2)C1=CC=C(S1)C(O)=O)C(=O)OC(C)(C)C |
| InChi: | InChI=1S/C17H24N2O4S/c1-17(2,3)23-16(22)19-7-6-12-11(9-19)10(8-18-12)13-4-5-14(24-13)15(20)21/h4-5,10-12,18H,6-9H2,1-3H3,(H,20,21)/t10-,11+,12+/m0/s1 |
| InChiKey: | InChIKey=WYJPPHFXXRKWSL-QJPTWQEYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.