* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115119-001 |
| English Synonyms: | WUXIAPPTEC WX115119-001 ; WUXIAPPTEC WX115119-010 ; WUXIAPPTEC WX115119-005 |
| MDL Number.: | MFCD17016603 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CC[C@@H]2NCC([C@@H]2C1)C1CCN(CC1)C(=O)OCC1=CC=CC=C1 |
| InChi: | InChI=1S/C25H37N3O4/c1-25(2,3)32-24(30)28-14-11-22-21(16-28)20(15-26-22)19-9-12-27(13-10-19)23(29)31-17-18-7-5-4-6-8-18/h4-8,19-22,26H,9-17H2,1-3H3/t20?,21-,22-/m0/s1 |
| InChiKey: | InChIKey=UFSRYEDELOWYBQ-QIFDKBNDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.