* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115120-001 |
| English Synonyms: | WUXIAPPTEC WX115120-010 ; WUXIAPPTEC WX115120-001 ; WUXIAPPTEC WX115120-005 |
| MDL Number.: | MFCD17016604 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CC[C@@H]2NCC([C@@H]2C1)C1CCCN(C1)C(=O)OCC1=CC=CC=C1 |
| InChi: | InChI=1S/C25H37N3O4/c1-25(2,3)32-24(30)28-13-11-22-21(16-28)20(14-26-22)19-10-7-12-27(15-19)23(29)31-17-18-8-5-4-6-9-18/h4-6,8-9,19-22,26H,7,10-17H2,1-3H3/t19?,20?,21-,22-/m0/s1 |
| InChiKey: | InChIKey=CUZJJRGKXQGSAU-UJKMTWAASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.