* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115123-001 |
| English Synonyms: | WUXIAPPTEC WX115123-001 ; WUXIAPPTEC WX115123-005 ; WUXIAPPTEC WX115123-010 |
| MDL Number.: | MFCD17016607 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CC2CCC3=C(NC=N3)C2C1 |
| InChi: | InChI=1S/C14H21N3O2/c1-14(2,3)19-13(18)17-6-9-4-5-11-12(10(9)7-17)16-8-15-11/h8-10H,4-7H2,1-3H3,(H,15,16) |
| InChiKey: | InChIKey=UWERXOVUGJAWOV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.