* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115130-001 |
| English Synonyms: | WUXIAPPTEC WX115130-005 ; WUXIAPPTEC WX115130-010 ; WUXIAPPTEC WX115130-001 |
| MDL Number.: | MFCD17016613 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | [H][C@@]12CN[C@]1([H])C1=CC=CC=C1N(C2)C(=O)OCC1=CC=CC=C1 |
| InChi: | InChI=1S/C18H18N2O2/c21-18(22-12-13-6-2-1-3-7-13)20-11-14-10-19-17(14)15-8-4-5-9-16(15)20/h1-9,14,17,19H,10-12H2/t14-,17-/m0/s1 |
| InChiKey: | InChIKey=OCSLDTYJLFPYPM-YOEHRIQHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.