* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115152-001 |
| English Synonyms: | WUXIAPPTEC WX115152-001 ; WUXIAPPTEC WX115152-005 ; WUXIAPPTEC WX115152-010 |
| MDL Number.: | MFCD17016628 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCOC(=O)C1CCN2CCC3=C(C=CN3)C12 |
| InChi: | InChI=1S/C13H18N2O2/c1-2-17-13(16)10-4-7-15-8-5-11-9(12(10)15)3-6-14-11/h3,6,10,12,14H,2,4-5,7-8H2,1H3 |
| InChiKey: | InChIKey=RVSLHRFSUBIWTQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.