* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115155-001 |
| English Synonyms: | WUXIAPPTEC WX115155-001 ; WUXIAPPTEC WX115155-005 ; WUXIAPPTEC WX115155-010 |
| MDL Number.: | MFCD17016630 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | OCC1C2CC3=C(N2C1=O)C(Cl)=NC(Cl)=N3 |
| InChi: | InChI=1S/C9H7Cl2N3O2/c10-7-6-4(12-9(11)13-7)1-5-3(2-15)8(16)14(5)6/h3,5,15H,1-2H2 |
| InChiKey: | InChIKey=BEIJVVKDSNBSJY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.