* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115160-001 |
| English Synonyms: | WUXIAPPTEC WX115160-001 ; WUXIAPPTEC WX115160-010 ; WUXIAPPTEC WX115160-005 |
| MDL Number.: | MFCD17016633 |
| H bond acceptor: | 8 |
| H bond donor: | 0 |
| Smile: | CC(C)(C)OC(=O)N1CCC2(OCCN(C2C1)C(=O)OCC1=CC=CC=C1)C1=NC=CS1 |
| InChi: | InChI=1S/C23H29N3O5S/c1-22(2,3)31-20(27)25-11-9-23(19-24-10-14-32-19)18(15-25)26(12-13-30-23)21(28)29-16-17-7-5-4-6-8-17/h4-8,10,14,18H,9,11-13,15-16H2,1-3H3 |
| InChiKey: | InChIKey=QODPYIQNRBUBGJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.