* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115177-001 |
| English Synonyms: | WUXIAPPTEC WX115177-005 ; WUXIAPPTEC WX115177-010 ; WUXIAPPTEC WX115177-001 |
| MDL Number.: | MFCD17016648 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CC(C)(C)OC(=O)N1C[C@@H]2OCCNC[C@@]2(C1)C1=CNC=N1 |
| InChi: | InChI=1S/C15H24N4O3/c1-14(2,3)22-13(20)19-7-12-15(9-19,8-16-4-5-21-12)11-6-17-10-18-11/h6,10,12,16H,4-5,7-9H2,1-3H3,(H,17,18)/t12-,15+/m0/s1 |
| InChiKey: | InChIKey=XCIIGSQUXFEHBC-SWLSCSKDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.