* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115184-001 |
| English Synonyms: | WUXIAPPTEC WX115184-005 ; WUXIAPPTEC WX115184-001 ; WUXIAPPTEC WX115184-010 |
| MDL Number.: | MFCD17016653 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CC[C@@]2(OCCNC[C@@H]2C1)C1=CC=CS1 |
| InChi: | InChI=1S/C17H26N2O3S/c1-16(2,3)22-15(20)19-8-6-17(14-5-4-10-23-14)13(12-19)11-18-7-9-21-17/h4-5,10,13,18H,6-9,11-12H2,1-3H3/t13-,17+/m1/s1 |
| InChiKey: | InChIKey=WCAOZBUXZAPKCX-DYVFJYSZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.