* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115186-001 |
| English Synonyms: | WUXIAPPTEC WX115186-001 ; WUXIAPPTEC WX115186-010 ; WUXIAPPTEC WX115186-005 |
| MDL Number.: | MFCD17016655 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CC[C@H]2CNCCO[C@]2(C1)C1=CC=CC=C1 |
| InChi: | InChI=1S/C19H28N2O3/c1-18(2,3)24-17(22)21-11-9-16-13-20-10-12-23-19(16,14-21)15-7-5-4-6-8-15/h4-8,16,20H,9-14H2,1-3H3/t16-,19+/m0/s1 |
| InChiKey: | InChIKey=KCLKBWJWNCOAIR-QFBILLFUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.