* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115188-001 |
| English Synonyms: | WUXIAPPTEC WX115188-001 ; WUXIAPPTEC WX115188-005 ; WUXIAPPTEC WX115188-010 |
| MDL Number.: | MFCD17016657 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCOC(=O)C12CCC1C1=C(C2)C=NN1 |
| InChi: | InChI=1S/C11H14N2O2/c1-2-15-10(14)11-4-3-8(11)9-7(5-11)6-12-13-9/h6,8H,2-5H2,1H3,(H,12,13) |
| InChiKey: | InChIKey=HUUCSBWICDGNFC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.