* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH925505 |
English Synonyms: | FCHGROUP FCH925505 |
MDL Number.: | MFCD17016661 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C1CC23C(CC2C1=O)CNC3=O |
InChi: | InChI=1S/C9H11NO2/c11-7-1-2-9-5(3-6(7)9)4-10-8(9)12/h5-6H,1-4H2,(H,10,12) |
InChiKey: | InChIKey=PBHQQCLLVOXFEY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.