* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | WUXIAPPTEC WX115194-001 |
English Synonyms: | WUXIAPPTEC WX115194-001 ; WUXIAPPTEC WX115194-010 ; WUXIAPPTEC WX115194-005 |
MDL Number.: | MFCD17016663 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCOC(=O)C12CCC(=O)C1C1CCNCCC21 |
InChi: | InChI=1S/C14H21NO3/c1-2-18-13(17)14-6-3-11(16)12(14)9-4-7-15-8-5-10(9)14/h9-10,12,15H,2-8H2,1H3 |
InChiKey: | InChIKey=LQVVJAPUWFNPPY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.