* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX120027 |
| English Synonyms: | WUXIAPPTEC WX120027 |
| MDL Number.: | MFCD17016686 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1C2CC([C@H]1C(=O)O)C(C2)(F)F |
| InChi: | InChI=1S/C12H17F2NO4/c1-11(2,3)19-10(18)15-6-4-7(8(15)9(16)17)12(13,14)5-6/h6-8H,4-5H2,1-3H3,(H,16,17)/t6?,7?,8-/m0/s1 |
| InChiKey: | InChIKey=MECKAPAHVJNZBE-RRQHEKLDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.