* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX120037 |
| English Synonyms: | WUXIAPPTEC WX120037 |
| MDL Number.: | MFCD17016696 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1C2CCC([C@H]1C(=O)O)C(C2)(F)F |
| InChi: | InChI=1S/C13H19F2NO4/c1-12(2,3)20-11(19)16-7-4-5-8(9(16)10(17)18)13(14,15)6-7/h7-9H,4-6H2,1-3H3,(H,17,18)/t7?,8?,9-/m0/s1 |
| InChiKey: | InChIKey=BOLCEYWUYSTOAK-HACHORDNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.