* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX120131-001 |
| English Synonyms: | WUXIAPPTEC WX120131-001 ; WUXIAPPTEC WX120131-010 ; WUXIAPPTEC WX120131-005 |
| MDL Number.: | MFCD17016768 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CCOC(=O)[C@@H]1C2CCC3[C@H]1NS(=O)(=O)N23 |
| InChi: | InChI=1S/C9H14N2O4S/c1-2-15-9(12)7-5-3-4-6-8(7)10-16(13,14)11(5)6/h5-8,10H,2-4H2,1H3/t5?,6?,7-,8-/m1/s1 |
| InChiKey: | InChIKey=CLXAKTZXSFFQKW-DWYQZRHDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.