* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | WUXIAPPTEC WX120138-001 |
English Synonyms: | WUXIAPPTEC WX120138-001 ; WUXIAPPTEC WX120138-005 ; WUXIAPPTEC WX120138-010 |
MDL Number.: | MFCD17016773 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | NC1CC2CCC1CN2C(=O)OCC1=CC=CC=C1 |
InChi: | InChI=1S/C15H20N2O2/c16-14-8-13-7-6-12(14)9-17(13)15(18)19-10-11-4-2-1-3-5-11/h1-5,12-14H,6-10,16H2 |
InChiKey: | InChIKey=ZLLLIIVGYJDRFO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.