* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | WUXIAPPTEC WX120150-001 |
English Synonyms: | WUXIAPPTEC WX120150-001 ; WUXIAPPTEC WX120150-005 ; WUXIAPPTEC WX120150-010 |
MDL Number.: | MFCD17016785 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | NC1CC2C[C@H](C1)CN(C2)C(=O)OCC1=CC=CC=C1 |
InChi: | InChI=1S/C16H22N2O2/c17-15-7-13-6-14(8-15)10-18(9-13)16(19)20-11-12-4-2-1-3-5-12/h1-5,13-15H,6-11,17H2/t13-,14?,15?/m1/s1 |
InChiKey: | InChIKey=NCZJCWNPMPPTQN-GIJJTGMTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.