* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX120151-001 |
| English Synonyms: | WUXIAPPTEC WX120151-010 ; WUXIAPPTEC WX120151-001 ; WUXIAPPTEC WX120151-005 |
| MDL Number.: | MFCD17016786 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | O=C(OCC1=CC=CC=C1)N1CC2CNC(=O)C(C1)O2 |
| InChi: | InChI=1S/C14H16N2O4/c17-13-12-8-16(7-11(20-12)6-15-13)14(18)19-9-10-4-2-1-3-5-10/h1-5,11-12H,6-9H2,(H,15,17) |
| InChiKey: | InChIKey=FMBIIZLLKDDBBA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.