* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX120156-001 |
| English Synonyms: | WUXIAPPTEC WX120156-010 ; WUXIAPPTEC WX120156-005 ; WUXIAPPTEC WX120156-001 |
| MDL Number.: | MFCD17016791 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | COC(=O)C12CC(C1)CC(C2)NC(=O)OC(C)(C)C |
| InChi: | InChI=1S/C14H23NO4/c1-13(2,3)19-12(17)15-10-5-9-6-14(7-9,8-10)11(16)18-4/h9-10H,5-8H2,1-4H3,(H,15,17) |
| InChiKey: | InChIKey=GXOBTMKULYXEJR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.