* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX120160-001 |
| English Synonyms: | WUXIAPPTEC WX120160-005 ; WUXIAPPTEC WX120160-001 ; WUXIAPPTEC WX120160-010 |
| MDL Number.: | MFCD17016795 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCOC(=O)[C@H]1C[N@@]2CC[C@H]1[C@H](O)C2 |
| InChi: | InChI=1S/C10H17NO3/c1-2-14-10(13)8-5-11-4-3-7(8)9(12)6-11/h7-9,12H,2-6H2,1H3/t7-,8+,9-/m1/s1 |
| InChiKey: | InChIKey=IXQNAYYKYCRYEN-HRDYMLBCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.