* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | WUXIAPPTEC WX120162-001 |
English Synonyms: | WUXIAPPTEC WX120162-005 ; WUXIAPPTEC WX120162-001 ; WUXIAPPTEC WX120162-010 |
MDL Number.: | MFCD17016797 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCOC(=O)[C@H]1C[N@@]2CC[C@H]1[C@@H](N)C2 |
InChi: | InChI=1S/C10H18N2O2/c1-2-14-10(13)8-5-12-4-3-7(8)9(11)6-12/h7-9H,2-6,11H2,1H3/t7-,8+,9+/m1/s1 |
InChiKey: | InChIKey=KJHJXBBXQNAXDM-VGMNWLOBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.