* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX125046-001 |
| English Synonyms: | WUXIAPPTEC WX125046-005 ; WUXIAPPTEC WX125046-010 ; WUXIAPPTEC WX125046-001 |
| MDL Number.: | MFCD17016837 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CCC2(CC1)C1CCC2(N)CC1 |
| InChi: | InChI=1S/C16H28N2O2/c1-14(2,3)20-13(19)18-10-8-15(9-11-18)12-4-6-16(15,17)7-5-12/h12H,4-11,17H2,1-3H3 |
| InChiKey: | InChIKey=FWUMQMBQQKXJPH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.