* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX125054-001 |
| English Synonyms: | WUXIAPPTEC WX125054-005 ; WUXIAPPTEC WX125054-010 ; WUXIAPPTEC WX125054-001 |
| MDL Number.: | MFCD17016844 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | CSC1=NC2=C(C=N1)C1CC2CN1C(=O)OC(C)(C)C |
| InChi: | InChI=1S/C14H19N3O2S/c1-14(2,3)19-13(18)17-7-8-5-10(17)9-6-15-12(20-4)16-11(8)9/h6,8,10H,5,7H2,1-4H3 |
| InChiKey: | InChIKey=PFEDISFGOBKBKL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.