* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX125060-001 |
| English Synonyms: | WUXIAPPTEC WX125060-010 ; WUXIAPPTEC WX125060-005 ; WUXIAPPTEC WX125060-001 |
| MDL Number.: | MFCD17016850 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CC2CCC1C1=C2C(I)=NN1 |
| InChi: | InChI=1S/C13H18IN3O2/c1-13(2,3)19-12(18)17-6-7-4-5-8(17)10-9(7)11(14)16-15-10/h7-8H,4-6H2,1-3H3,(H,15,16) |
| InChiKey: | InChIKey=BDEPFIACHDUACT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.