* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX125064-001 |
| English Synonyms: | WUXIAPPTEC WX125064-001 ; WUXIAPPTEC WX125064-010 ; WUXIAPPTEC WX125064-005 |
| MDL Number.: | MFCD17016853 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | BrC1=NC2=C(S1)C1CCCC(C2)N1C(=O)OCC1=CC=CC=C1 |
| InChi: | InChI=1S/C17H17BrN2O2S/c18-16-19-13-9-12-7-4-8-14(15(13)23-16)20(12)17(21)22-10-11-5-2-1-3-6-11/h1-3,5-6,12,14H,4,7-10H2 |
| InChiKey: | InChIKey=FDFSJIMVFGUUBK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.