* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX125071-001 |
| English Synonyms: | WUXIAPPTEC WX125071-005 ; WUXIAPPTEC WX125071-001 ; WUXIAPPTEC WX125071-010 |
| MDL Number.: | MFCD17016860 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1C2CCC1C(C2)C1=CNN=C1 |
| InChi: | InChI=1S/C14H21N3O2/c1-14(2,3)19-13(18)17-10-4-5-12(17)11(6-10)9-7-15-16-8-9/h7-8,10-12H,4-6H2,1-3H3,(H,15,16) |
| InChiKey: | InChIKey=PYSQSDHZBBGOHX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.