* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX125073-001 |
| English Synonyms: | WUXIAPPTEC WX125073-005 ; WUXIAPPTEC WX125073-001 ; WUXIAPPTEC WX125073-010 |
| MDL Number.: | MFCD17016861 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1C2CCC1C(O)(C2)C1=NC=CS1 |
| InChi: | InChI=1S/C14H20N2O3S/c1-13(2,3)19-12(17)16-9-4-5-10(16)14(18,8-9)11-15-6-7-20-11/h6-7,9-10,18H,4-5,8H2,1-3H3 |
| InChiKey: | InChIKey=FBQJDCHTVMJNEH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.