* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX125078-001 |
| English Synonyms: | WUXIAPPTEC WX125078-001 ; WUXIAPPTEC WX125107-005 ; WUXIAPPTEC WX125107-010 ; WUXIAPPTEC WX125107-001 ; WUXIAPPTEC WX125078-010 ; WUXIAPPTEC WX125078-005 |
| MDL Number.: | MFCD17016864 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CC2(C1)CC1CCC2CNC1 |
| InChi: | InChI=1S/C15H26N2O2/c1-14(2,3)19-13(18)17-9-15(10-17)6-11-4-5-12(15)8-16-7-11/h11-12,16H,4-10H2,1-3H3 |
| InChiKey: | InChIKey=JBLONEBJRCXAAR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.