* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX125079-001 |
| English Synonyms: | WUXIAPPTEC WX125108-010 ; WUXIAPPTEC WX125079-001 ; WUXIAPPTEC WX125079-010 ; WUXIAPPTEC WX125108-005 ; WUXIAPPTEC WX125108-001 ; WUXIAPPTEC WX125079-005 |
| MDL Number.: | MFCD17016865 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CC2(C1)CC1CNCC2O1 |
| InChi: | InChI=1S/C13H22N2O3/c1-12(2,3)18-11(16)15-7-13(8-15)4-9-5-14-6-10(13)17-9/h9-10,14H,4-8H2,1-3H3 |
| InChiKey: | InChIKey=RCAAQXKTEYEWSQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.