* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX135029-001 |
| English Synonyms: | WUXIAPPTEC WX135029-010 ; WUXIAPPTEC WX135029-005 ; WUXIAPPTEC WX135029-001 |
| MDL Number.: | MFCD17016886 |
| H bond acceptor: | 8 |
| H bond donor: | 0 |
| Smile: | CCOC(=O)C1=CN2C(=N1)C1=C(CN(C1)C(=O)OC(C)(C)C)N=C2Cl |
| InChi: | InChI=1S/C16H19ClN4O4/c1-5-24-13(22)11-8-21-12(18-11)9-6-20(7-10(9)19-14(21)17)15(23)25-16(2,3)4/h8H,5-7H2,1-4H3 |
| InChiKey: | InChIKey=KFGAUTDTDGVXTC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.