* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX135043-001 |
| English Synonyms: | WUXIAPPTEC WX135043-005 ; WUXIAPPTEC WX135043-001 ; WUXIAPPTEC WX135043-010 |
| MDL Number.: | MFCD17016900 |
| H bond acceptor: | 7 |
| H bond donor: | 0 |
| Smile: | CCOC(=O)C1=C2N(C=N1)C(Cl)=NC1=C2N=CC=N1 |
| InChi: | InChI=1S/C11H8ClN5O2/c1-2-19-10(18)7-8-6-9(14-4-3-13-6)16-11(12)17(8)5-15-7/h3-5H,2H2,1H3 |
| InChiKey: | InChIKey=JWMJXBNUCKHWPB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.