* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH1352034 |
| English Synonyms: | FCHGROUP FCH1352034 |
| MDL Number.: | MFCD17016918 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | C1Cc2c(c(n[nH]2)I)NC1 |
| InChi: | InChI=1S/C6H8IN3/c7-6-5-4(9-10-6)2-1-3-8-5/h8H,1-3H2,(H,9,10) |
| InChiKey: | InChIKey=MWYPOWBFFWIQAG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.