* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX145032-001 |
English Synonyms: | WUXIAPPTEC WX145032-010 ; WUXIAPPTEC WX145032-005 ; WUXIAPPTEC WX145032-001 |
MDL Number.: | MFCD17016930 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | BrC1=CC2=C(OCC3=C(NC=N3)N2)C=C1 |
InChi: | InChI=1S/C10H8BrN3O/c11-6-1-2-9-7(3-6)14-10-8(4-15-9)12-5-13-10/h1-3,5,14H,4H2,(H,12,13) |
InChiKey: | InChIKey=UJSBXBBFKZQTDT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.