* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX145040-001 |
| English Synonyms: | WUXIAPPTEC WX145040-001 ; WUXIAPPTEC WX145040-005 ; WUXIAPPTEC WX145040-010 |
| MDL Number.: | MFCD17016937 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | COC(=O)C1=C2C=CC=CC2=C2COC(CI)CN12 |
| InChi: | InChI=1S/C14H14INO3/c1-18-14(17)13-11-5-3-2-4-10(11)12-8-19-9(6-15)7-16(12)13/h2-5,9H,6-8H2,1H3 |
| InChiKey: | InChIKey=GCNONVZVIDRJDO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.