* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX155017-001 |
English Synonyms: | WUXIAPPTEC WX155017-001 ; WUXIAPPTEC WX155017-010 ; WUXIAPPTEC WX155017-005 |
MDL Number.: | MFCD17016986 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | ClC1=NC(=NC=C1)C1=NN2C=C(Br)C=CC2=N1 |
InChi: | InChI=1S/C10H5BrClN5/c11-6-1-2-8-15-10(16-17(8)5-6)9-13-4-3-7(12)14-9/h1-5H |
InChiKey: | InChIKey=TWZMKBOZJPALON-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.