* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX155034-001 |
English Synonyms: | WUXIAPPTEC WX155034-010 ; WUXIAPPTEC WX155034-001 ; WUXIAPPTEC WX155034-005 |
MDL Number.: | MFCD17017002 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | CCOC(=O)C1=C2C=CC=CN2C(=N1)C1=NC(Cl)=NC=C1 |
InChi: | InChI=1S/C14H11ClN4O2/c1-2-21-13(20)11-10-5-3-4-8-19(10)12(18-11)9-6-7-16-14(15)17-9/h3-8H,2H2,1H3 |
InChiKey: | InChIKey=LYIXHJBQQFKFSW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.