* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX165031-001 |
| English Synonyms: | WUXIAPPTEC WX165031-005 ; WUXIAPPTEC WX165031-001 ; WUXIAPPTEC WX165031-010 |
| MDL Number.: | MFCD17017020 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | ClC1=NC=CC(=C1)C1CNC2=CC=CC=C2N1 |
| InChi: | InChI=1S/C13H12ClN3/c14-13-7-9(5-6-15-13)12-8-16-10-3-1-2-4-11(10)17-12/h1-7,12,16-17H,8H2 |
| InChiKey: | InChIKey=MPYFJCKMACJFLX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.