* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX165036-001 |
English Synonyms: | WUXIAPPTEC WX165036-010 ; WUXIAPPTEC WX165036-001 ; WUXIAPPTEC WX165036-005 |
MDL Number.: | MFCD17017025 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | BrC1=CN2C=NC(C3CCNC3)=C2C=C1 |
InChi: | InChI=1S/C11H12BrN3/c12-9-1-2-10-11(8-3-4-13-5-8)14-7-15(10)6-9/h1-2,6-8,13H,3-5H2 |
InChiKey: | InChIKey=YVUCSAIOEVDGMO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.