* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX165047-001 |
| English Synonyms: | WUXIAPPTEC WX165047-005 ; WUXIAPPTEC WX165047-001 ; WUXIAPPTEC WX165047-010 |
| MDL Number.: | MFCD17017033 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | BrC1=CN2C(C=C1)=NC=C2C1CNCCO1 |
| InChi: | InChI=1S/C11H12BrN3O/c12-8-1-2-11-14-5-9(15(11)7-8)10-6-13-3-4-16-10/h1-2,5,7,10,13H,3-4,6H2 |
| InChiKey: | InChIKey=VNCXYIFYQZMPLY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.