* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX165064-001 |
English Synonyms: | WUXIAPPTEC WX165064-001 ; WUXIAPPTEC WX165064-010 ; WUXIAPPTEC WX165064-005 |
MDL Number.: | MFCD17017048 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | OC(=O)C1=CN2C(=CC=C2N2CCNCC2)C=C1 |
InChi: | InChI=1S/C13H15N3O2/c17-13(18)10-1-2-11-3-4-12(16(11)9-10)15-7-5-14-6-8-15/h1-4,9,14H,5-8H2,(H,17,18) |
InChiKey: | InChIKey=MVPSXYMJAPKKTQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.